C15H15F4N5O3 — CID 134124533
N-[(Z)-[1-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-fluorophenyl]-2,2,2-trifluoroethylidene]amino]-N-methylmethanamine (PubChem CID 134124533) has the molecular formula C15H15F4N5O3 and a molecular weight of 389.31 g/mol. Its IUPAC name is N-[(Z)-[1-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-fluorophenyl]-2,2,2-trifluoroethylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(Z)-[1-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-fluorophenyl]-2,2,2-trifluoroethylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 134124533 |
| Molecular Formula | C15H15F4N5O3 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(Z)-[1-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-fluorophenyl]-2,2,2-trifluoroethylidene]amino]-N-methylmethanamine |
| SMILES | COc1nc(OC)nc(Oc2cccc(F)c2/C(=N/N(C)C)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F4N5O3/c1-24(2)23-11(15(17,18)19)10-8(16)6-5-7-9(10)27-14-21-12(25-3)20-13(22-14)26-4/h5-7H,1-4H3/b23-11- |
| InChIKey | KULVBPROWPVNRF-KSEXSDGBSA-N |
| XLogP | 2.65 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|