About 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile
5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile (PubChem CID 134124654) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile.
Molecular Properties
| Compound Name | 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile |
| PubChem CID | 134124654 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile |
| SMILES | N#CCCCCOc1cnc(N)nc1N |
| InChI | InChI=1S/C9H13N5O/c10-4-2-1-3-5-15-7-6-13-9(12)14-8(7)11/h6H,1-3,5H2,(H4,11,12,13,14) |
| InChIKey | LZEHUPDVYSJRJV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile?
The IUPAC name of 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile (CID 134124654) is 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile.
What is the SMILES notation for 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile?
The canonical SMILES for 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile is N#CCCCCOc1cnc(N)nc1N.
What is the InChIKey of 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile?
The InChIKey is LZEHUPDVYSJRJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c10-4-2-1-3-5-15-7-6-13-9(12)14-8(7)11/h6H,1-3,5H2,(H4,11,12,13,14).
What are the key properties of 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile?
5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile has a molecular weight of 207.24 g/mol, XLogP of 0.71, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-diaminopyrimidin-5-yl)oxypentanenitrile is sourced from PubChem (CID 134124654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).