C28H28N4O2 — CID 13412588
3-[5-(6-oxo-3-phenylpyridazin-1-yl)pentyl]-1,1-diphenylurea (PubChem CID 13412588) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3-[5-(6-oxo-3-phenylpyridazin-1-yl)pentyl]-1,1-diphenylurea.
| Compound Name | 3-[5-(6-oxo-3-phenylpyridazin-1-yl)pentyl]-1,1-diphenylurea |
|---|---|
| PubChem CID | 13412588 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3-[5-(6-oxo-3-phenylpyridazin-1-yl)pentyl]-1,1-diphenylurea |
| SMILES | O=C(NCCCCCn1nc(-c2ccccc2)ccc1=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N4O2/c33-27-20-19-26(23-13-5-1-6-14-23)30-31(27)22-12-4-11-21-29-28(34)32(24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-3,5-10,13-20H,4,11-12,21-22H2,(H,29,34) |
| InChIKey | KIMYDFFBBDWMKC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|