About sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate
sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate (PubChem CID 134126170) has the molecular formula C13H13N2NaO7S
and a molecular weight of 364.31 g/mol. Its IUPAC name is sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate.
Molecular Properties
| Compound Name | sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate |
| PubChem CID | 134126170 |
| Molecular Formula | C13H13N2NaO7S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(O)S(=O)(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C13H14N2O7S.Na/c1-20-10-7-11(21-2)15-13(14-10)22-9-6-4-3-5-8(9)12(16)23(17,18)19;/h3-7,12,16H,1-2H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | MYMZGUZWCNXSSP-UHFFFAOYSA-M |
| XLogP | -2.17 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate?
The IUPAC name of sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate (CID 134126170) is sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate.
What is the SMILES notation for sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate?
The canonical SMILES for sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate is COc1cc(OC)nc(Oc2ccccc2C(O)S(=O)(=O)[O-])n1.[Na+].
What is the InChIKey of sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate?
The InChIKey is MYMZGUZWCNXSSP-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H14N2O7S.Na/c1-20-10-7-11(21-2)15-13(14-10)22-9-6-4-3-5-8(9)12(16)23(17,18)19;/h3-7,12,16H,1-2H3,(H,17,18,19);/q;+1/p-1.
What are the key properties of sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate?
sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate has a molecular weight of 364.31 g/mol, XLogP of -2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-hydroxymethanesulfonate is sourced from PubChem (CID 134126170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).