About (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide
(2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide (PubChem CID 134126473) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide.
Molecular Properties
| Compound Name | (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide |
| PubChem CID | 134126473 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide |
| SMILES | CC1CC(NC(=O)[C@H](C)O)=NN1C |
| InChI | InChI=1S/C8H15N3O2/c1-5-4-7(10-11(5)3)9-8(13)6(2)12/h5-6,12H,4H2,1-3H3,(H,9,10,13)/t5?,6-/m0/s1 |
| InChIKey | ODXIUSDIDGDOHH-GDVGLLTNSA-N |
| XLogP | -0.48 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide?
The IUPAC name of (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide (CID 134126473) is (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide.
What is the SMILES notation for (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide?
The canonical SMILES for (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide is CC1CC(NC(=O)[C@H](C)O)=NN1C.
What is the InChIKey of (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide?
The InChIKey is ODXIUSDIDGDOHH-GDVGLLTNSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-5-4-7(10-11(5)3)9-8(13)6(2)12/h5-6,12H,4H2,1-3H3,(H,9,10,13)/t5?,6-/m0/s1.
What are the key properties of (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide?
(2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide has a molecular weight of 185.23 g/mol, XLogP of -0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,3-dimethyl-3,4-dihydropyrazol-5-yl)-2-hydroxypropanamide is sourced from PubChem (CID 134126473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).