C14H21BClNO2 — CID 134126551
5-chloro-2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 134126551) has the molecular formula C14H21BClNO2 and a molecular weight of 281.59 g/mol. Its IUPAC name is 5-chloro-2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 5-chloro-2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 134126551 |
| Molecular Formula | C14H21BClNO2 |
| Molecular Weight | 281.59 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-chloro-2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCCc1cc(B2OC(C)(C)C(C)(C)O2)c(Cl)cn1 |
| InChI | InChI=1S/C14H21BClNO2/c1-6-7-10-8-11(12(16)9-17-10)15-18-13(2,3)14(4,5)19-15/h8-9H,6-7H2,1-5H3 |
| InChIKey | QQNBVGXQARGLFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|