About 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine
2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine (PubChem CID 134126957) has the molecular formula C19H20F3N3O2
and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine |
| PubChem CID | 134126957 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine |
| SMILES | COCc1nc2cc(N(C)C)ccc2n1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-24(2)14-6-9-17-16(10-14)23-18(12-26-3)25(17)11-13-4-7-15(8-5-13)27-19(20,21)22/h4-10H,11-12H2,1-3H3 |
| InChIKey | QEYDVXPXZNWRCP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine?
The IUPAC name of 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine (CID 134126957) is 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine.
What is the SMILES notation for 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine?
The canonical SMILES for 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine is COCc1nc2cc(N(C)C)ccc2n1Cc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine?
The InChIKey is QEYDVXPXZNWRCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3N3O2/c1-24(2)14-6-9-17-16(10-14)23-18(12-26-3)25(17)11-13-4-7-15(8-5-13)27-19(20,21)22/h4-10H,11-12H2,1-3H3.
What are the key properties of 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine?
2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine has a molecular weight of 379.38 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-N,N-dimethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazol-5-amine is sourced from PubChem (CID 134126957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).