C22H21F2NO2 — CID 134127167
2-[3,4-bis[(4-fluorophenyl)methoxy]phenyl]ethanamine (PubChem CID 134127167) has the molecular formula C22H21F2NO2 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[3,4-bis[(4-fluorophenyl)methoxy]phenyl]ethanamine.
| Compound Name | 2-[3,4-bis[(4-fluorophenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 134127167 |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[3,4-bis[(4-fluorophenyl)methoxy]phenyl]ethanamine |
| SMILES | NCCc1ccc(OCc2ccc(F)cc2)c(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H21F2NO2/c23-19-6-1-17(2-7-19)14-26-21-10-5-16(11-12-25)13-22(21)27-15-18-3-8-20(24)9-4-18/h1-10,13H,11-12,14-15,25H2 |
| InChIKey | YGLGTTVHUQIFPR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |