C21H26N4O2 — CID 134127310
N-[(1R,2R)-2-phenylmethoxycyclopentyl]-5-pyridin-4-ylpyrazolidine-3-carboxamide (PubChem CID 134127310) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(1R,2R)-2-phenylmethoxycyclopentyl]-5-pyridin-4-ylpyrazolidine-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-phenylmethoxycyclopentyl]-5-pyridin-4-ylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134127310 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[(1R,2R)-2-phenylmethoxycyclopentyl]-5-pyridin-4-ylpyrazolidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]1OCc1ccccc1)C1CC(c2ccncc2)NN1 |
| InChI | InChI=1S/C21H26N4O2/c26-21(19-13-18(24-25-19)16-9-11-22-12-10-16)23-17-7-4-8-20(17)27-14-15-5-2-1-3-6-15/h1-3,5-6,9-12,17-20,24-25H,4,7-8,13-14H2,(H,23,26)/t17-,18?,19?,20-/m1/s1 |
| InChIKey | QFIVVUDWGBTGNA-YNIZLOQISA-N |
| XLogP | 2.24 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |