C20H29N7 — CID 134127673
3-(2-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)-5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine (PubChem CID 134127673) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-(2-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)-5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(2-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)-5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 134127673 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 3-(2-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)-5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine |
| SMILES | CN1CCC2NNC(c3nc(-c4ccncc4)nn3C3CCCCC3)C2C1 |
| InChI | InChI=1S/C20H29N7/c1-26-12-9-17-16(13-26)18(24-23-17)20-22-19(14-7-10-21-11-8-14)25-27(20)15-5-3-2-4-6-15/h7-8,10-11,15-18,23-24H,2-6,9,12-13H2,1H3 |
| InChIKey | KSXVHFCPJTTYTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |