About oxane-2-carboxylic acid;phenylmethanamine
oxane-2-carboxylic acid;phenylmethanamine (PubChem CID 134128733) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is oxane-2-carboxylic acid;phenylmethanamine.
Molecular Properties
| Compound Name | oxane-2-carboxylic acid;phenylmethanamine |
| PubChem CID | 134128733 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | oxane-2-carboxylic acid;phenylmethanamine |
| SMILES | NCc1ccccc1.O=C(O)C1CCCCO1 |
| InChI | InChI=1S/C7H9N.C6H10O3/c8-6-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-9-5/h1-5H,6,8H2;5H,1-4H2,(H,7,8) |
| InChIKey | ZEZRAWKBBUQTSC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxane-2-carboxylic acid;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2-carboxylic acid;phenylmethanamine?
The IUPAC name of oxane-2-carboxylic acid;phenylmethanamine (CID 134128733) is oxane-2-carboxylic acid;phenylmethanamine.
What is the SMILES notation for oxane-2-carboxylic acid;phenylmethanamine?
The canonical SMILES for oxane-2-carboxylic acid;phenylmethanamine is NCc1ccccc1.O=C(O)C1CCCCO1.
What is the InChIKey of oxane-2-carboxylic acid;phenylmethanamine?
The InChIKey is ZEZRAWKBBUQTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H10O3/c8-6-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-9-5/h1-5H,6,8H2;5H,1-4H2,(H,7,8).
What are the key properties of oxane-2-carboxylic acid;phenylmethanamine?
oxane-2-carboxylic acid;phenylmethanamine has a molecular weight of 237.30 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2-carboxylic acid;phenylmethanamine is sourced from PubChem (CID 134128733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).