About 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone
1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone (PubChem CID 134129151) has the molecular formula C12H11N3O4
and a molecular weight of 261.24 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone |
| PubChem CID | 134129151 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone |
| SMILES | Cc1noc(CC(=O)c2ccccc2N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O4/c1-7-12(15(17)18)11(19-14-7)6-10(16)8-4-2-3-5-9(8)13/h2-5H,6,13H2,1H3 |
| InChIKey | AYKGXSGOJXFHIR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone?
The IUPAC name of 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone (CID 134129151) is 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone?
The canonical SMILES for 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone is Cc1noc(CC(=O)c2ccccc2N)c1[N+](=O)[O-].
What is the InChIKey of 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone?
The InChIKey is AYKGXSGOJXFHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c1-7-12(15(17)18)11(19-14-7)6-10(16)8-4-2-3-5-9(8)13/h2-5H,6,13H2,1H3.
What are the key properties of 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone?
1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone has a molecular weight of 261.24 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminophenyl)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethanone is sourced from PubChem (CID 134129151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).