C9H12ClN5 — CID 134129170
N-butyl-5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-amine (PubChem CID 134129170) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is N-butyl-5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-amine.
| Compound Name | N-butyl-5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 134129170 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-butyl-5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-amine |
| SMILES | CCCCNc1nnc2cncc(Cl)n12 |
| InChI | InChI=1S/C9H12ClN5/c1-2-3-4-12-9-14-13-8-6-11-5-7(10)15(8)9/h5-6H,2-4H2,1H3,(H,12,14) |
| InChIKey | LQBNPVNMERGEOW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|