C11H10BrNO3 — CID 134129683
ethyl 5-bromo-4-methyl-1,2-benzoxazole-3-carboxylate (PubChem CID 134129683) has the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. Its IUPAC name is ethyl 5-bromo-4-methyl-1,2-benzoxazole-3-carboxylate.
| Compound Name | ethyl 5-bromo-4-methyl-1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 134129683 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | ethyl 5-bromo-4-methyl-1,2-benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc2ccc(Br)c(C)c12 |
| InChI | InChI=1S/C11H10BrNO3/c1-3-15-11(14)10-9-6(2)7(12)4-5-8(9)16-13-10/h4-5H,3H2,1-2H3 |
| InChIKey | UMETZWGUUWPXPZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |