About 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one
3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one (PubChem CID 134129911) has the molecular formula C19H12F3N3OS
and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one.
Molecular Properties
| Compound Name | 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one |
| PubChem CID | 134129911 |
| Molecular Formula | C19H12F3N3OS |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one |
| SMILES | Nc1ncc(-c2cn(Cc3ccc(F)cc3)c3c(F)cc(F)cc3c2=O)s1 |
| InChI | InChI=1S/C19H12F3N3OS/c20-11-3-1-10(2-4-11)8-25-9-14(16-7-24-19(23)27-16)18(26)13-5-12(21)6-15(22)17(13)25/h1-7,9H,8H2,(H2,23,24) |
| InChIKey | RSRKQKVNDJVABT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one?
The IUPAC name of 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one (CID 134129911) is 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one.
What is the SMILES notation for 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one?
The canonical SMILES for 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one is Nc1ncc(-c2cn(Cc3ccc(F)cc3)c3c(F)cc(F)cc3c2=O)s1.
What is the InChIKey of 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one?
The InChIKey is RSRKQKVNDJVABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N3OS/c20-11-3-1-10(2-4-11)8-25-9-14(16-7-24-19(23)27-16)18(26)13-5-12(21)6-15(22)17(13)25/h1-7,9H,8H2,(H2,23,24).
What are the key properties of 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one?
3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one has a molecular weight of 387.39 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-1,3-thiazol-5-yl)-6,8-difluoro-1-[(4-fluorophenyl)methyl]quinolin-4-one is sourced from PubChem (CID 134129911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).