C28H31N3O5 — CID 134129954
N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2-(2,4-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 134129954) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2-(2,4-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2-(2,4-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 134129954 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2-(2,4-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1ccc(-n2cc(C(=O)NCC(=O)NCCC3=CCCCC3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C28H31N3O5/c1-35-20-12-13-24(25(16-20)36-2)31-18-23(21-10-6-7-11-22(21)28(31)34)27(33)30-17-26(32)29-15-14-19-8-4-3-5-9-19/h6-8,10-13,16,18H,3-5,9,14-15,17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | WEYUVNMOHKORGF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|