C19H20N4O2 — CID 134130064
[(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2,2-dimethylpropanoate (PubChem CID 134130064) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134130064 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O/N=C(\Cn1cncn1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H20N4O2/c1-19(2,3)18(24)25-22-17(11-23-13-20-12-21-23)16-9-8-14-6-4-5-7-15(14)10-16/h4-10,12-13H,11H2,1-3H3/b22-17+ |
| InChIKey | QODMBCCPHYDKOK-OQKWZONESA-N |
| XLogP | 3.42 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|