C36H41N5O2S — CID 134130069
N-[5-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]pentyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 134130069) has the molecular formula C36H41N5O2S and a molecular weight of 607.82 g/mol. Its IUPAC name is N-[5-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]pentyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[5-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]pentyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 134130069 |
| Molecular Formula | C36H41N5O2S |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | N-[5-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]pentyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CCCCCNc4c5c(nc6ccccc46)CCCC5)CC3)cccc21 |
| InChI | InChI=1S/C36H41N5O2S/c42-44(43,28-12-3-1-4-13-28)41-23-20-31-34(18-11-19-35(31)41)40-26-24-39(25-27-40)22-10-2-9-21-37-36-29-14-5-7-16-32(29)38-33-17-8-6-15-30(33)36/h1,3-5,7,11-14,16,18-20,23H,2,6,8-10,15,17,21-22,24-27H2,(H,37,38) |
| InChIKey | QVMOLXHRHHMTTI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|