About methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate
methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate (PubChem CID 134130106) has the molecular formula C23H27F2NO4
and a molecular weight of 419.47 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate.
Molecular Properties
| Compound Name | methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate |
| PubChem CID | 134130106 |
| Molecular Formula | C23H27F2NO4 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate |
| SMILES | CCCC(C)COc1ccc([C@@H](NC(=O)Cc2ccc(F)cc2F)C(=O)OC)cc1 |
| InChI | InChI=1S/C23H27F2NO4/c1-4-5-15(2)14-30-19-10-7-16(8-11-19)22(23(28)29-3)26-21(27)12-17-6-9-18(24)13-20(17)25/h6-11,13,15,22H,4-5,12,14H2,1-3H3,(H,26,27)/t15?,22-/m1/s1 |
| InChIKey | JPGRXCXCYRVCPJ-ZZAPORBBSA-N |
| XLogP | 4.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate?
The IUPAC name of methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate (CID 134130106) is methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate.
What is the SMILES notation for methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate?
The canonical SMILES for methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate is CCCC(C)COc1ccc([C@@H](NC(=O)Cc2ccc(F)cc2F)C(=O)OC)cc1.
What is the InChIKey of methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate?
The InChIKey is JPGRXCXCYRVCPJ-ZZAPORBBSA-N. The full InChI is InChI=1S/C23H27F2NO4/c1-4-5-15(2)14-30-19-10-7-16(8-11-19)22(23(28)29-3)26-21(27)12-17-6-9-18(24)13-20(17)25/h6-11,13,15,22H,4-5,12,14H2,1-3H3,(H,26,27)/t15?,22-/m1/s1.
What are the key properties of methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate?
methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate has a molecular weight of 419.47 g/mol, XLogP of 4.35, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[[2-(2,4-difluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate is sourced from PubChem (CID 134130106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).