C26H27F2N3O4 — CID 134130161
(2S)-3-(4-fluorophenyl)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]propanamide (PubChem CID 134130161) has the molecular formula C26H27F2N3O4 and a molecular weight of 483.52 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenyl)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]propanamide.
| Compound Name | (2S)-3-(4-fluorophenyl)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 134130161 |
| Molecular Formula | C26H27F2N3O4 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (2S)-3-(4-fluorophenyl)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]propanamide |
| SMILES | O=C[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C26H27F2N3O4/c27-20-8-3-17(4-9-20)7-12-24(33)31-23(14-18-5-10-21(28)11-6-18)26(35)30-22(16-32)15-19-2-1-13-29-25(19)34/h3-12,16,19,22-23H,1-2,13-15H2,(H,29,34)(H,30,35)(H,31,33)/b12-7+/t19-,22-,23-/m0/s1 |
| InChIKey | MKUVNPHACKCPCL-ZLHMBYMRSA-N |
| XLogP | 2.31 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|