About tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate
tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate (PubChem CID 134130176) has the molecular formula C26H30N4O2
and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate |
| PubChem CID | 134130176 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate |
| SMILES | C/C(=N/NC(=O)OC(C)(C)C)C(c1cn(C)c2ccccc12)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C26H30N4O2/c1-17(27-28-25(31)32-26(2,3)4)24(20-15-29(5)22-13-9-7-11-18(20)22)21-16-30(6)23-14-10-8-12-19(21)23/h7-16,24H,1-6H3,(H,28,31)/b27-17- |
| InChIKey | CISOEGONJCBOJW-PKAZHMFMSA-N |
| XLogP | 5.70 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate?
The IUPAC name of tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate (CID 134130176) is tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate.
What is the SMILES notation for tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate?
The canonical SMILES for tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate is C/C(=N/NC(=O)OC(C)(C)C)C(c1cn(C)c2ccccc12)c1cn(C)c2ccccc12.
What is the InChIKey of tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate?
The InChIKey is CISOEGONJCBOJW-PKAZHMFMSA-N. The full InChI is InChI=1S/C26H30N4O2/c1-17(27-28-25(31)32-26(2,3)4)24(20-15-29(5)22-13-9-7-11-18(20)22)21-16-30(6)23-14-10-8-12-19(21)23/h7-16,24H,1-6H3,(H,28,31)/b27-17-.
What are the key properties of tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate?
tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate has a molecular weight of 430.55 g/mol, XLogP of 5.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-1,1-bis(1-methylindol-3-yl)propan-2-ylideneamino]carbamate is sourced from PubChem (CID 134130176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).