About 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide
2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide (PubChem CID 134130246) has the molecular formula C19H21BrN2S
and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide.
Molecular Properties
| Compound Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide |
| PubChem CID | 134130246 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide |
| SMILES | Br.c1ccc2c(c1)CCN(CCCc1nc3ccccc3s1)C2 |
| InChI | InChI=1S/C19H20N2S.BrH/c1-2-7-16-14-21(13-11-15(16)6-1)12-5-10-19-20-17-8-3-4-9-18(17)22-19;/h1-4,6-9H,5,10-14H2;1H |
| InChIKey | FWJIGGZKXTXJRN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide?
The IUPAC name of 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide (CID 134130246) is 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide.
What is the SMILES notation for 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide?
The canonical SMILES for 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide is Br.c1ccc2c(c1)CCN(CCCc1nc3ccccc3s1)C2.
What is the InChIKey of 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide?
The InChIKey is FWJIGGZKXTXJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2S.BrH/c1-2-7-16-14-21(13-11-15(16)6-1)12-5-10-19-20-17-8-3-4-9-18(17)22-19;/h1-4,6-9H,5,10-14H2;1H.
What are the key properties of 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide?
2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide has a molecular weight of 389.36 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1,3-benzothiazole;hydrobromide is sourced from PubChem (CID 134130246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).