About 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide
2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide (PubChem CID 134130286) has the molecular formula C19H13Cl2N5O3
and a molecular weight of 430.25 g/mol. Its IUPAC name is 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide |
| PubChem CID | 134130286 |
| Molecular Formula | C19H13Cl2N5O3 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1cc(CN2C(=O)C(=O)c3c(Cl)ccc(Cl)c32)nn1)Nc1ccccc1 |
| InChI | InChI=1S/C19H13Cl2N5O3/c20-13-6-7-14(21)17-16(13)18(28)19(29)26(17)9-12-8-25(24-23-12)10-15(27)22-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,22,27) |
| InChIKey | FVBYXXICVIAUHN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide?
The IUPAC name of 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide (CID 134130286) is 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide?
The canonical SMILES for 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide is O=C(Cn1cc(CN2C(=O)C(=O)c3c(Cl)ccc(Cl)c32)nn1)Nc1ccccc1.
What is the InChIKey of 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide?
The InChIKey is FVBYXXICVIAUHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2N5O3/c20-13-6-7-14(21)17-16(13)18(28)19(29)26(17)9-12-8-25(24-23-12)10-15(27)22-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,22,27).
What are the key properties of 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide?
2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide has a molecular weight of 430.25 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]-N-phenylacetamide is sourced from PubChem (CID 134130286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).