C18H12Cl2N6O2 — CID 134130344
1,6-bis(4-chlorophenyl)-7-oxopyrazolo[4,5-d]pyridazine-4-carbohydrazide (PubChem CID 134130344) has the molecular formula C18H12Cl2N6O2 and a molecular weight of 415.24 g/mol. Its IUPAC name is 1,6-bis(4-chlorophenyl)-7-oxopyrazolo[4,5-d]pyridazine-4-carbohydrazide.
| Compound Name | 1,6-bis(4-chlorophenyl)-7-oxopyrazolo[4,5-d]pyridazine-4-carbohydrazide |
|---|---|
| PubChem CID | 134130344 |
| Molecular Formula | C18H12Cl2N6O2 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 1,6-bis(4-chlorophenyl)-7-oxopyrazolo[4,5-d]pyridazine-4-carbohydrazide |
| SMILES | NNC(=O)c1nn(-c2ccc(Cl)cc2)c(=O)c2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2N6O2/c19-10-1-5-12(6-2-10)25-16-14(9-22-25)15(17(27)23-21)24-26(18(16)28)13-7-3-11(20)4-8-13/h1-9H,21H2,(H,23,27) |
| InChIKey | SBRHSRXUDZYWSR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|