C20H23ClN4O2 — CID 134130347
[(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2-methylpentanoate;hydrochloride (PubChem CID 134130347) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2-methylpentanoate;hydrochloride.
| Compound Name | [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2-methylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 134130347 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [(Z)-[1-naphthalen-2-yl-2-(1,2,4-triazol-1-yl)ethylidene]amino] 2-methylpentanoate;hydrochloride |
| SMILES | CCCC(C)C(=O)O/N=C(\Cn1cncn1)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C20H22N4O2.ClH/c1-3-6-15(2)20(25)26-23-19(12-24-14-21-13-22-24)18-10-9-16-7-4-5-8-17(16)11-18;/h4-5,7-11,13-15H,3,6,12H2,1-2H3;1H/b23-19+; |
| InChIKey | VEPULCHCMKQCCK-IMPZXOFZSA-N |
| XLogP | 4.24 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|