C34H37N5O2S — CID 134130413
N-[3-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]propyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 134130413) has the molecular formula C34H37N5O2S and a molecular weight of 579.77 g/mol. Its IUPAC name is N-[3-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]propyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[3-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]propyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 134130413 |
| Molecular Formula | C34H37N5O2S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-[3-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]propyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CCCNc4c5c(nc6ccccc46)CCCC5)CC3)cccc21 |
| InChI | InChI=1S/C34H37N5O2S/c40-42(41,26-10-2-1-3-11-26)39-21-18-29-32(16-8-17-33(29)39)38-24-22-37(23-25-38)20-9-19-35-34-27-12-4-6-14-30(27)36-31-15-7-5-13-28(31)34/h1-4,6,8,10-12,14,16-18,21H,5,7,9,13,15,19-20,22-25H2,(H,35,36) |
| InChIKey | DHTIEPUWNIRXPY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|