C24H31NO10 — CID 134130419
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(4-phenylbutanoylamino)oxan-2-yl]methyl acetate (PubChem CID 134130419) has the molecular formula C24H31NO10 and a molecular weight of 493.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(4-phenylbutanoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(4-phenylbutanoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134130419 |
| Molecular Formula | C24H31NO10 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(4-phenylbutanoylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)CCCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H31NO10/c1-14(26)31-13-19-22(32-15(2)27)23(33-16(3)28)21(24(35-19)34-17(4)29)25-20(30)12-8-11-18-9-6-5-7-10-18/h5-7,9-10,19,21-24H,8,11-13H2,1-4H3,(H,25,30)/t19-,21-,22-,23-,24-/m1/s1 |
| InChIKey | WOPVMYUGAQOKPF-JTYPQFNSSA-N |
| XLogP | 1.21 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|