C15H14N2O3S2 — CID 134130536
2-(4-methylsulfonylphenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one (PubChem CID 134130536) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-methylsulfonylphenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134130536 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one |
| SMILES | CS(=O)(=O)c1ccc(C2SCC(=O)N2c2ccccn2)cc1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-22(19,20)12-7-5-11(6-8-12)15-17(14(18)10-21-15)13-4-2-3-9-16-13/h2-9,15H,10H2,1H3 |
| InChIKey | NEOVJRGGEBVOKZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |