About N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide
N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide (PubChem CID 134130610) has the molecular formula C19H19Cl2N5O3
and a molecular weight of 436.30 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide |
| PubChem CID | 134130610 |
| Molecular Formula | C19H19Cl2N5O3 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(CN2C(=O)C(=O)c3c(Cl)ccc(Cl)c32)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C19H19Cl2N5O3/c20-13-6-7-14(21)17-16(13)18(28)19(29)26(17)9-12-8-25(24-23-12)10-15(27)22-11-4-2-1-3-5-11/h6-8,11H,1-5,9-10H2,(H,22,27) |
| InChIKey | INXAPSFXSJPIAX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide?
The IUPAC name of N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide (CID 134130610) is N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide.
What is the SMILES notation for N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide?
The canonical SMILES for N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide is O=C(Cn1cc(CN2C(=O)C(=O)c3c(Cl)ccc(Cl)c32)nn1)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide?
The InChIKey is INXAPSFXSJPIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N5O3/c20-13-6-7-14(21)17-16(13)18(28)19(29)26(17)9-12-8-25(24-23-12)10-15(27)22-11-4-2-1-3-5-11/h6-8,11H,1-5,9-10H2,(H,22,27).
What are the key properties of N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide?
N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide has a molecular weight of 436.30 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-[4-[(4,7-dichloro-2,3-dioxoindol-1-yl)methyl]triazol-1-yl]acetamide is sourced from PubChem (CID 134130610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).