C31H34F3NO3 — CID 134130975
(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-6-[N-prop-2-ynoxy-C-[4-(trifluoromethyl)phenyl]carbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134130975) has the molecular formula C31H34F3NO3 and a molecular weight of 525.61 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-6-[N-prop-2-ynoxy-C-[4-(trifluoromethyl)phenyl]carbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-6-[N-prop-2-ynoxy-C-[4-(trifluoromethyl)phenyl]carbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134130975 |
| Molecular Formula | C31H34F3NO3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-6-[N-prop-2-ynoxy-C-[4-(trifluoromethyl)phenyl]carbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C#CCON=C(c1ccc(C(F)(F)F)cc1)c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C31H34F3NO3/c1-6-16-38-35-27(20-8-11-22(12-9-20)31(32,33)34)24-18-25-21(17-23(24)19(2)3)10-13-26-29(25,4)14-7-15-30(26,5)28(36)37/h1,8-9,11-12,17-19,26H,7,10,13-16H2,2-5H3,(H,36,37)/t26-,29-,30-/m1/s1 |
| InChIKey | SYZIVBFLBPGWHU-KXTWMDTESA-N |
| XLogP | 7.33 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|