C24H25ClO2 — CID 134131063
(8R,9S,13S,14S)-4-(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 134131063) has the molecular formula C24H25ClO2 and a molecular weight of 380.92 g/mol. Its IUPAC name is (8R,9S,13S,14S)-4-(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-4-(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 134131063 |
| Molecular Formula | C24H25ClO2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (8R,9S,13S,14S)-4-(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)c(-c5ccc(Cl)cc5)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H25ClO2/c1-24-13-12-17-16-8-10-21(26)23(14-2-4-15(25)5-3-14)19(16)7-6-18(17)20(24)9-11-22(24)27/h2-5,8,10,17-18,20,26H,6-7,9,11-13H2,1H3/t17-,18-,20+,24+/m1/s1 |
| InChIKey | UVBKVMWKVZALFZ-OMANQYLTSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |