C29H33N7O3 — CID 134131077
(12E)-20-amino-22-methyl-6-(pyrazol-1-ylmethyl)-9,17-dioxa-1,21,25,29-tetrazatetracyclo[25.2.1.03,8.018,23]triaconta-3(8),4,6,12,18,20,22,27(30),28-nonaen-26-one (PubChem CID 134131077) has the molecular formula C29H33N7O3 and a molecular weight of 527.63 g/mol. Its IUPAC name is (12E)-20-amino-22-methyl-6-(pyrazol-1-ylmethyl)-9,17-dioxa-1,21,25,29-tetrazatetracyclo[25.2.1.03,8.018,23]triaconta-3(8),4,6,12,18,20,22,27(30),28-nonaen-26-one.
| Compound Name | (12E)-20-amino-22-methyl-6-(pyrazol-1-ylmethyl)-9,17-dioxa-1,21,25,29-tetrazatetracyclo[25.2.1.03,8.018,23]triaconta-3(8),4,6,12,18,20,22,27(30),28-nonaen-26-one |
|---|---|
| PubChem CID | 134131077 |
| Molecular Formula | C29H33N7O3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (12E)-20-amino-22-methyl-6-(pyrazol-1-ylmethyl)-9,17-dioxa-1,21,25,29-tetrazatetracyclo[25.2.1.03,8.018,23]triaconta-3(8),4,6,12,18,20,22,27(30),28-nonaen-26-one |
| SMILES | Cc1nc(N)cc2c1CNC(=O)c1cnn(c1)Cc1ccc(Cn3cccn3)cc1OCC/C=C/CCCO2 |
| InChI | InChI=1S/C29H33N7O3/c1-21-25-17-31-29(37)24-16-33-36(20-24)19-23-9-8-22(18-35-11-7-10-32-35)14-26(23)38-12-5-3-2-4-6-13-39-27(25)15-28(30)34-21/h2-3,7-11,14-16,20H,4-6,12-13,17-19H2,1H3,(H2,30,34)(H,31,37)/b3-2+ |
| InChIKey | OSLSJEGJCLYVFN-NSCUHMNNSA-N |
| XLogP | 3.89 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|