C37H39BrN2O3 — CID 134131230
2-[2-(2-methoxyethoxy)ethoxymethyl]-5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide (PubChem CID 134131230) has the molecular formula C37H39BrN2O3 and a molecular weight of 639.63 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxymethyl]-5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxymethyl]-5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide |
|---|---|
| PubChem CID | 134131230 |
| Molecular Formula | C37H39BrN2O3 |
| Molecular Weight | 639.63 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxymethyl]-5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide |
| SMILES | COCCOCCOCc1n(Cc2ccc3ccccc3c2)c2cc(C)c(C)cc2[n+]1Cc1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C37H39N2O3.BrH/c1-27-20-35-36(21-28(27)2)39(25-30-13-15-32-9-5-7-11-34(32)23-30)37(26-42-19-18-41-17-16-40-3)38(35)24-29-12-14-31-8-4-6-10-33(31)22-29;/h4-15,20-23H,16-19,24-26H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VZOQYGXIQRZIFS-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 36.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|