About cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid
cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (PubChem CID 13413125) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| PubChem CID | 13413125 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-2-5(4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | JBZDHFKPEDWWJC-RITPCOANSA-N |
| XLogP | 0.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (CID 13413125) is cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid is O=C(O)[C@@H]1CCC[C@H](O)C1.
What is the InChIKey of cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid?
The InChIKey is JBZDHFKPEDWWJC-RITPCOANSA-N. The full InChI is InChI=1S/C7H12O3/c8-6-3-1-2-5(4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6+/m1/s1.
What are the key properties of cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid?
cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid has a molecular weight of 144.17 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 13413125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).