C37H43N5O2S — CID 134131252
N-[6-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]hexyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 134131252) has the molecular formula C37H43N5O2S and a molecular weight of 621.85 g/mol. Its IUPAC name is N-[6-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]hexyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[6-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]hexyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 134131252 |
| Molecular Formula | C37H43N5O2S |
| Molecular Weight | 621.85 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | N-[6-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]hexyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CCCCCCNc4c5c(nc6ccccc46)CCCC5)CC3)cccc21 |
| InChI | InChI=1S/C37H43N5O2S/c43-45(44,29-13-4-3-5-14-29)42-24-21-32-35(19-12-20-36(32)42)41-27-25-40(26-28-41)23-11-2-1-10-22-38-37-30-15-6-8-17-33(30)39-34-18-9-7-16-31(34)37/h3-6,8,12-15,17,19-21,24H,1-2,7,9-11,16,18,22-23,25-28H2,(H,38,39) |
| InChIKey | INTOYXAUMDZZCK-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.85 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|