C32H39N5O2S — CID 134131296
N-[2-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]ethyl]-1-benzylpiperidin-4-amine (PubChem CID 134131296) has the molecular formula C32H39N5O2S and a molecular weight of 557.76 g/mol. Its IUPAC name is N-[2-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]ethyl]-1-benzylpiperidin-4-amine.
| Compound Name | N-[2-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]ethyl]-1-benzylpiperidin-4-amine |
|---|---|
| PubChem CID | 134131296 |
| Molecular Formula | C32H39N5O2S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[2-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]ethyl]-1-benzylpiperidin-4-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CCNC4CCN(Cc5ccccc5)CC4)CC3)cccc21 |
| InChI | InChI=1S/C32H39N5O2S/c38-40(39,29-10-5-2-6-11-29)37-20-16-30-31(12-7-13-32(30)37)36-24-22-34(23-25-36)21-17-33-28-14-18-35(19-15-28)26-27-8-3-1-4-9-27/h1-13,16,20,28,33H,14-15,17-19,21-26H2 |
| InChIKey | YDYOZLWYBAEKHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |