C38H45N5O2S — CID 134131347
N-[7-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 134131347) has the molecular formula C38H45N5O2S and a molecular weight of 635.88 g/mol. Its IUPAC name is N-[7-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[7-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 134131347 |
| Molecular Formula | C38H45N5O2S |
| Molecular Weight | 635.88 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | N-[7-[4-[1-(benzenesulfonyl)indol-4-yl]piperazin-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CCCCCCCNc4c5c(nc6ccccc46)CCCC5)CC3)cccc21 |
| InChI | InChI=1S/C38H45N5O2S/c44-46(45,30-14-5-4-6-15-30)43-25-22-33-36(20-13-21-37(33)43)42-28-26-41(27-29-42)24-12-3-1-2-11-23-39-38-31-16-7-9-18-34(31)40-35-19-10-8-17-32(35)38/h4-7,9,13-16,18,20-22,25H,1-3,8,10-12,17,19,23-24,26-29H2,(H,39,40) |
| InChIKey | QVCWJIWRPGTNSS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.88 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|