C30H27FO2 — CID 134131514
(14S,17S,21S,22R)-11-(2-fluorophenyl)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one (PubChem CID 134131514) has the molecular formula C30H27FO2 and a molecular weight of 438.54 g/mol. Its IUPAC name is (14S,17S,21S,22R)-11-(2-fluorophenyl)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one.
| Compound Name | (14S,17S,21S,22R)-11-(2-fluorophenyl)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one |
|---|---|
| PubChem CID | 134131514 |
| Molecular Formula | C30H27FO2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (14S,17S,21S,22R)-11-(2-fluorophenyl)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(-c5ccccc5F)c5oc6ccccc6c5c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C30H27FO2/c1-30-15-14-17-18(24(30)12-13-27(30)32)10-11-20-22(17)16-23(19-6-2-4-8-25(19)31)29-28(20)21-7-3-5-9-26(21)33-29/h2-9,16-18,24H,10-15H2,1H3/t17-,18+,24-,30-/m0/s1 |
| InChIKey | DLQKCCBLQZFRHA-NTAGVTQGSA-N |
| XLogP | 7.82 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |