C24H24O2 — CID 134131552
(14S,17S,21S,22R)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one (PubChem CID 134131552) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (14S,17S,21S,22R)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one.
| Compound Name | (14S,17S,21S,22R)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one |
|---|---|
| PubChem CID | 134131552 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (14S,17S,21S,22R)-17-methyl-9-oxahexacyclo[11.11.0.02,10.03,8.014,22.017,21]tetracosa-1(13),2(10),3,5,7,11-hexaen-18-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc5oc6ccccc6c5c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H24O2/c1-24-13-12-15-14-8-10-21-23(18-4-2-3-5-20(18)26-21)17(14)7-6-16(15)19(24)9-11-22(24)25/h2-5,8,10,15-16,19H,6-7,9,11-13H2,1H3/t15-,16-,19+,24+/m1/s1 |
| InChIKey | DOSJFEVROJRDQF-NLFPWZOASA-N |
| XLogP | 6.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |