C32H47NO3 — CID 134132001
(1S,2R,10R,13R,14R,17S,20R,21R,22R)-17-(hydroxymethyl)-2,4,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-5-oxa-6-azahexacyclo[11.11.0.02,10.03,7.014,22.017,21]tetracosa-3,6-dien-8-one (PubChem CID 134132001) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (1S,2R,10R,13R,14R,17S,20R,21R,22R)-17-(hydroxymethyl)-2,4,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-5-oxa-6-azahexacyclo[11.11.0.02,10.03,7.014,22.017,21]tetracosa-3,6-dien-8-one.
| Compound Name | (1S,2R,10R,13R,14R,17S,20R,21R,22R)-17-(hydroxymethyl)-2,4,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-5-oxa-6-azahexacyclo[11.11.0.02,10.03,7.014,22.017,21]tetracosa-3,6-dien-8-one |
|---|---|
| PubChem CID | 134132001 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (1S,2R,10R,13R,14R,17S,20R,21R,22R)-17-(hydroxymethyl)-2,4,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-5-oxa-6-azahexacyclo[11.11.0.02,10.03,7.014,22.017,21]tetracosa-3,6-dien-8-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(CO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)c6c(noc6C)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C32H47NO3/c1-18(2)20-11-14-32(17-34)16-15-29(6)21(25(20)32)9-10-23-30(29,7)13-12-22-28(4,5)27(35)26-24(31(22,23)8)19(3)36-33-26/h20-23,25,34H,1,9-17H2,2-8H3/t20-,21+,22-,23-,25+,29+,30+,31-,32+/m0/s1 |
| InChIKey | XXLFELVHQDPPFG-ODNUERSKSA-N |
| XLogP | 7.29 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|