C23H19F2N5O3 — CID 134132021
1-(3,5-difluorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea (PubChem CID 134132021) has the molecular formula C23H19F2N5O3 and a molecular weight of 451.43 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
|---|---|
| PubChem CID | 134132021 |
| Molecular Formula | C23H19F2N5O3 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4cc(F)cc(F)c4)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C23H19F2N5O3/c1-32-17-9-16(10-18(11-17)33-2)28-22-19-4-3-5-20(21(19)26-12-27-22)30-23(31)29-15-7-13(24)6-14(25)8-15/h3-12H,1-2H3,(H,26,27,28)(H2,29,30,31) |
| InChIKey | JEXCEMHZNQZEAD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |