About tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate
tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate (PubChem CID 134132098) has the molecular formula C21H20BrCl2NO3S
and a molecular weight of 517.27 g/mol. Its IUPAC name is tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate |
| PubChem CID | 134132098 |
| Molecular Formula | C21H20BrCl2NO3S |
| Molecular Weight | 517.27 g/mol |
| Exact Mass | 514.97 |
| IUPAC Name | tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate |
| SMILES | Cn1c(CSc2c(Cl)cccc2Cl)c(C(=O)OC(C)(C)C)c2cc(O)c(Br)cc21 |
| InChI | InChI=1S/C21H20BrCl2NO3S/c1-21(2,3)28-20(27)18-11-8-17(26)12(22)9-15(11)25(4)16(18)10-29-19-13(23)6-5-7-14(19)24/h5-9,26H,10H2,1-4H3 |
| InChIKey | DMTFWYDVOGFFCX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.27 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate?
The IUPAC name of tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate (CID 134132098) is tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate.
What is the SMILES notation for tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate?
The canonical SMILES for tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate is Cn1c(CSc2c(Cl)cccc2Cl)c(C(=O)OC(C)(C)C)c2cc(O)c(Br)cc21.
What is the InChIKey of tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate?
The InChIKey is DMTFWYDVOGFFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BrCl2NO3S/c1-21(2,3)28-20(27)18-11-8-17(26)12(22)9-15(11)25(4)16(18)10-29-19-13(23)6-5-7-14(19)24/h5-9,26H,10H2,1-4H3.
What are the key properties of tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate?
tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate has a molecular weight of 517.27 g/mol, XLogP of 7.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-bromo-2-[(2,6-dichlorophenyl)sulfanylmethyl]-5-hydroxy-1-methylindole-3-carboxylate is sourced from PubChem (CID 134132098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).