C15H22N2O4 — CID 134132157
4-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-methylbutanamide (PubChem CID 134132157) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-methylbutanamide.
| Compound Name | 4-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 134132157 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCN1C(=O)[C@@]2(C)[C@@H]3CC[C@@H](O3)[C@@]2(C)C1=O |
| InChI | InChI=1S/C15H22N2O4/c1-14-9-6-7-10(21-9)15(14,2)13(20)17(12(14)19)8-4-5-11(18)16-3/h9-10H,4-8H2,1-3H3,(H,16,18)/t9-,10+,14+,15- |
| InChIKey | NCHHBHYIMZNCOH-FHYCKABGSA-N |
| XLogP | 0.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|