C23H27N3O4S — CID 134132280
N-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-yl]quinoline-8-sulfonamide (PubChem CID 134132280) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-yl]quinoline-8-sulfonamide.
| Compound Name | N-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 134132280 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-yl]quinoline-8-sulfonamide |
| SMILES | COc1ccccc1OCCN1CCC(NS(=O)(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C23H27N3O4S/c1-29-20-8-2-3-9-21(20)30-17-16-26-14-11-19(12-15-26)25-31(27,28)22-10-4-6-18-7-5-13-24-23(18)22/h2-10,13,19,25H,11-12,14-17H2,1H3 |
| InChIKey | PITRVDNYLFADRD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |