C22H24O3 — CID 134132337
7-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 134132337) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 7-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 7-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 134132337 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 7-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | CC1(C)[C@@H]2CC=C(COc3ccc4c5c(c(=O)oc4c3)CCC5)[C@H]1C2 |
| InChI | InChI=1S/C22H24O3/c1-22(2)14-7-6-13(19(22)10-14)12-24-15-8-9-17-16-4-3-5-18(16)21(23)25-20(17)11-15/h6,8-9,11,14,19H,3-5,7,10,12H2,1-2H3/t14-,19-/m1/s1 |
| InChIKey | IUWBZHKQPZGCOQ-AUUYWEPGSA-N |
| XLogP | 4.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|