C29H41N5O4 — CID 134132394
(6S,9R,12R)-6-[(2S)-butan-2-yl]-8,9-dimethyl-12-(pyridin-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 134132394) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is (6S,9R,12R)-6-[(2S)-butan-2-yl]-8,9-dimethyl-12-(pyridin-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6S,9R,12R)-6-[(2S)-butan-2-yl]-8,9-dimethyl-12-(pyridin-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 134132394 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | (6S,9R,12R)-6-[(2S)-butan-2-yl]-8,9-dimethyl-12-(pyridin-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC[C@H](C)[C@@H]1NCCOc2ccccc2CCCNC(=O)[C@@H](Cc2ccccn2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C29H41N5O4/c1-5-20(2)26-29(37)34(4)21(3)27(35)33-24(19-23-13-8-9-15-30-23)28(36)32-16-10-12-22-11-6-7-14-25(22)38-18-17-31-26/h6-9,11,13-15,20-21,24,26,31H,5,10,12,16-19H2,1-4H3,(H,32,36)(H,33,35)/t20-,21+,24+,26-/m0/s1 |
| InChIKey | QAXQOMNFNAUFNO-MIUUGJTFSA-N |
| XLogP | 2.10 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |