C12H16N2O4 — CID 134132514
2-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]acetamide (PubChem CID 134132514) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]acetamide.
| Compound Name | 2-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]acetamide |
|---|---|
| PubChem CID | 134132514 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[(3aR,4S,7R,7aS)-3a,7a-dimethyl-1,3-dioxo-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]acetamide |
| SMILES | C[C@@]12C(=O)N(CC(N)=O)C(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C12H16N2O4/c1-11-6-3-4-7(18-6)12(11,2)10(17)14(9(11)16)5-8(13)15/h6-7H,3-5H2,1-2H3,(H2,13,15)/t6-,7+,11+,12- |
| InChIKey | HPVIBMNHDQMPDD-AIQZBZIUSA-N |
| XLogP | -0.59 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|