C25H32N2O2 — CID 134132595
(3aR,3bS,5aS,8aS,8bS)-6-(5-ethoxy-3-pyridinyl)-1,3a,5a-trimethyl-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one (PubChem CID 134132595) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is (3aR,3bS,5aS,8aS,8bS)-6-(5-ethoxy-3-pyridinyl)-1,3a,5a-trimethyl-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one.
| Compound Name | (3aR,3bS,5aS,8aS,8bS)-6-(5-ethoxy-3-pyridinyl)-1,3a,5a-trimethyl-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one |
|---|---|
| PubChem CID | 134132595 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | (3aR,3bS,5aS,8aS,8bS)-6-(5-ethoxy-3-pyridinyl)-1,3a,5a-trimethyl-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one |
| SMILES | CCOc1cncc(C2=CC[C@H]3[C@@H]4CC=C5N(C)C(=O)C[C@]5(C)[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C25H32N2O2/c1-5-29-17-12-16(14-26-15-17)19-7-8-20-18-6-9-22-25(3,13-23(28)27(22)4)21(18)10-11-24(19,20)2/h7,9,12,14-15,18,20-21H,5-6,8,10-11,13H2,1-4H3/t18-,20-,21-,24+,25+/m0/s1 |
| InChIKey | KDQOFDJIIYPCTM-XPMKPVRUSA-N |
| XLogP | 5.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |