About 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole
2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole (PubChem CID 134132637) has the molecular formula C20H19N3OS
and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole |
| PubChem CID | 134132637 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole |
| SMILES | c1ccc(C(OCCCc2cnc[nH]2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H19N3OS/c1-2-7-15(8-3-1)19(24-12-6-9-16-13-21-14-22-16)20-23-17-10-4-5-11-18(17)25-20/h1-5,7-8,10-11,13-14,19H,6,9,12H2,(H,21,22) |
| InChIKey | KASGCKWFLGQGFX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole?
The IUPAC name of 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole (CID 134132637) is 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole?
The canonical SMILES for 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole is c1ccc(C(OCCCc2cnc[nH]2)c2nc3ccccc3s2)cc1.
What is the InChIKey of 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole?
The InChIKey is KASGCKWFLGQGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS/c1-2-7-15(8-3-1)19(24-12-6-9-16-13-21-14-22-16)20-23-17-10-4-5-11-18(17)25-20/h1-5,7-8,10-11,13-14,19H,6,9,12H2,(H,21,22).
What are the key properties of 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole?
2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole has a molecular weight of 349.46 g/mol, XLogP of 4.76, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1H-imidazol-5-yl)propoxy-phenylmethyl]-1,3-benzothiazole is sourced from PubChem (CID 134132637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).