C34H47N3O5 — CID 134132804
ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-acetylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134132804) has the molecular formula C34H47N3O5 and a molecular weight of 577.77 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-acetylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-acetylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134132804 |
| Molecular Formula | C34H47N3O5 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-acetylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@H](Cn1cc(COc2ccc(C(C)=O)cc2)nn1)[C@H]4O |
| InChI | InChI=1S/C34H47N3O5/c1-6-41-30(40)33(5)15-7-14-32(4)27(33)13-17-34-21-31(3,16-12-28(32)34)29(39)26(34)19-37-18-24(35-36-37)20-42-25-10-8-23(9-11-25)22(2)38/h8-11,18,26-29,39H,6-7,12-17,19-21H2,1-5H3/t26-,27+,28+,29-,31+,32-,33-,34-/m1/s1 |
| InChIKey | IKRDFPVWBSDMCK-XRVAKWLRSA-N |
| XLogP | 6.01 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |